C10H18O3 — CID 56999087
(4R,5S)-2,2-dimethyl-5-(2-methylpropyl)-1,3-dioxolane-4-carbaldehyde (PubChem CID 56999087) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (4R,5S)-2,2-dimethyl-5-(2-methylpropyl)-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4R,5S)-2,2-dimethyl-5-(2-methylpropyl)-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 56999087 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (4R,5S)-2,2-dimethyl-5-(2-methylpropyl)-1,3-dioxolane-4-carbaldehyde |
| SMILES | CC(C)C[C@@H]1OC(C)(C)O[C@H]1C=O |
| InChI | InChI=1S/C10H18O3/c1-7(2)5-8-9(6-11)13-10(3,4)12-8/h6-9H,5H2,1-4H3/t8-,9-/m0/s1 |
| InChIKey | SWELLWAVTWZHOO-IUCAKERBSA-N |
| XLogP | 1.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|