About 1-trichlorosilylhexadeca-11,13-diyn-4-ol
1-trichlorosilylhexadeca-11,13-diyn-4-ol (PubChem CID 56999202) has the molecular formula C16H25Cl3OSi
and a molecular weight of 367.82 g/mol. Its IUPAC name is 1-trichlorosilylhexadeca-11,13-diyn-4-ol.
Molecular Properties
| Compound Name | 1-trichlorosilylhexadeca-11,13-diyn-4-ol |
| PubChem CID | 56999202 |
| Molecular Formula | C16H25Cl3OSi |
| Molecular Weight | 367.82 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 1-trichlorosilylhexadeca-11,13-diyn-4-ol |
| SMILES | CCC#CC#CCCCCCCC(O)CCC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C16H25Cl3OSi/c1-2-3-4-5-6-7-8-9-10-11-13-16(20)14-12-15-21(17,18)19/h16,20H,2,7-15H2,1H3 |
| InChIKey | ROEGINBVMWPOOA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.82 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-trichlorosilylhexadeca-11,13-diyn-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-trichlorosilylhexadeca-11,13-diyn-4-ol?
The IUPAC name of 1-trichlorosilylhexadeca-11,13-diyn-4-ol (CID 56999202) is 1-trichlorosilylhexadeca-11,13-diyn-4-ol.
What is the SMILES notation for 1-trichlorosilylhexadeca-11,13-diyn-4-ol?
The canonical SMILES for 1-trichlorosilylhexadeca-11,13-diyn-4-ol is CCC#CC#CCCCCCCC(O)CCC[Si](Cl)(Cl)Cl.
What is the InChIKey of 1-trichlorosilylhexadeca-11,13-diyn-4-ol?
The InChIKey is ROEGINBVMWPOOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25Cl3OSi/c1-2-3-4-5-6-7-8-9-10-11-13-16(20)14-12-15-21(17,18)19/h16,20H,2,7-15H2,1H3.
What are the key properties of 1-trichlorosilylhexadeca-11,13-diyn-4-ol?
1-trichlorosilylhexadeca-11,13-diyn-4-ol has a molecular weight of 367.82 g/mol, XLogP of 5.54, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-trichlorosilylhexadeca-11,13-diyn-4-ol is sourced from PubChem (CID 56999202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).