C14H25N3 — CID 57000243
2-[1-(2-ethylpyrrol-2-yl)piperidin-4-yl]-N-methylethanamine (PubChem CID 57000243) has the molecular formula C14H25N3 and a molecular weight of 235.38 g/mol. Its IUPAC name is 2-[1-(2-ethylpyrrol-2-yl)piperidin-4-yl]-N-methylethanamine.
| Compound Name | 2-[1-(2-ethylpyrrol-2-yl)piperidin-4-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 57000243 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 2-[1-(2-ethylpyrrol-2-yl)piperidin-4-yl]-N-methylethanamine |
| SMILES | CCC1(N2CCC(CCNC)CC2)C=CC=N1 |
| InChI | InChI=1S/C14H25N3/c1-3-14(8-4-9-16-14)17-11-6-13(7-12-17)5-10-15-2/h4,8-9,13,15H,3,5-7,10-12H2,1-2H3 |
| InChIKey | QKXOPSKNNYSOEV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |