C30H42O3S — CID 57000283
(3S,5R,9R,10R,13R,17R)-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-4,4,10,13-tetramethyl-1,2,3,5,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 57000283) has the molecular formula C30H42O3S and a molecular weight of 482.73 g/mol. Its IUPAC name is (3S,5R,9R,10R,13R,17R)-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-4,4,10,13-tetramethyl-1,2,3,5,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5R,9R,10R,13R,17R)-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-4,4,10,13-tetramethyl-1,2,3,5,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 57000283 |
| Molecular Formula | C30H42O3S |
| Molecular Weight | 482.73 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | (3S,5R,9R,10R,13R,17R)-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-4,4,10,13-tetramethyl-1,2,3,5,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CS(=O)(=O)c1ccccc1)[C@H]1CCC2=C3C=C[C@H]4C(C)(C)[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C30H42O3S/c1-20(19-34(32,33)21-9-7-6-8-10-21)23-12-13-24-22-11-14-26-28(2,3)27(31)16-18-30(26,5)25(22)15-17-29(23,24)4/h6-11,14,20,23,25-27,31H,12-13,15-19H2,1-5H3/t20-,23-,25+,26+,27+,29-,30-/m1/s1 |
| InChIKey | LMWVLTPLHUZZHM-YGQQYFAKSA-N |
| XLogP | 6.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.73 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |