C17H15NO3 — CID 570005
2-benzoyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 570005) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-benzoyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | 2-benzoyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 570005 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-benzoyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2ccccc2CN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H15NO3/c19-16(12-6-2-1-3-7-12)18-11-14-9-5-4-8-13(14)10-15(18)17(20)21/h1-9,15H,10-11H2,(H,20,21) |
| InChIKey | QBBPKILWLZTVIC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |