About 1-[2-(2,3-dihydropyridin-2-yl)ethyl]piperazine
1-[2-(2,3-dihydropyridin-2-yl)ethyl]piperazine (PubChem CID 57000685) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-[2-(2,3-dihydropyridin-2-yl)ethyl]piperazine.
Molecular Properties
| Compound Name | 1-[2-(2,3-dihydropyridin-2-yl)ethyl]piperazine |
| PubChem CID | 57000685 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1-[2-(2,3-dihydropyridin-2-yl)ethyl]piperazine |
| SMILES | C1=CCC(CCN2CCNCC2)N=C1 |
| InChI | InChI=1S/C11H19N3/c1-2-5-13-11(3-1)4-8-14-9-6-12-7-10-14/h1-2,5,11-12H,3-4,6-10H2 |
| InChIKey | UXJYZEPCSWDBTH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(2,3-dihydropyridin-2-yl)ethyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,3-dihydropyridin-2-yl)ethyl]piperazine?
The IUPAC name of 1-[2-(2,3-dihydropyridin-2-yl)ethyl]piperazine (CID 57000685) is 1-[2-(2,3-dihydropyridin-2-yl)ethyl]piperazine.
What is the SMILES notation for 1-[2-(2,3-dihydropyridin-2-yl)ethyl]piperazine?
The canonical SMILES for 1-[2-(2,3-dihydropyridin-2-yl)ethyl]piperazine is C1=CCC(CCN2CCNCC2)N=C1.
What is the InChIKey of 1-[2-(2,3-dihydropyridin-2-yl)ethyl]piperazine?
The InChIKey is UXJYZEPCSWDBTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3/c1-2-5-13-11(3-1)4-8-14-9-6-12-7-10-14/h1-2,5,11-12H,3-4,6-10H2.
What are the key properties of 1-[2-(2,3-dihydropyridin-2-yl)ethyl]piperazine?
1-[2-(2,3-dihydropyridin-2-yl)ethyl]piperazine has a molecular weight of 193.29 g/mol, XLogP of 0.68, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,3-dihydropyridin-2-yl)ethyl]piperazine is sourced from PubChem (CID 57000685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).