C47H78N2O6 — CID 57000726
3-[2-[(1-octadec-9-enylcyclohexanecarbonyl)amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid (PubChem CID 57000726) has the molecular formula C47H78N2O6 and a molecular weight of 767.15 g/mol. Its IUPAC name is 3-[2-[(1-octadec-9-enylcyclohexanecarbonyl)amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[2-[(1-octadec-9-enylcyclohexanecarbonyl)amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 57000726 |
| Molecular Formula | C47H78N2O6 |
| Molecular Weight | 767.15 g/mol |
| Exact Mass | 766.59 |
| IUPAC Name | 3-[2-[(1-octadec-9-enylcyclohexanecarbonyl)amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCCC1(C(=O)NC2CCCCC2C(CC(=O)O)c2[nH]ccc2C(=O)C2OC(C)(C)OCC2(C)C)CCCCC1 |
| InChI | InChI=1S/C47H78N2O6/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-30-47(31-25-21-26-32-47)44(53)49-39-28-23-22-27-36(39)38(34-40(50)51)41-37(29-33-48-41)42(52)43-45(2,3)35-54-46(4,5)55-43/h13-14,29,33,36,38-39,43,48H,6-12,15-28,30-32,34-35H2,1-5H3,(H,49,53)(H,50,51) |
| InChIKey | XESDADJNGQJEED-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.15 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|