C12H19N3O — CID 57000786
4-butoxy-5,6,7,8-tetrahydroquinazolin-2-amine (PubChem CID 57000786) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 4-butoxy-5,6,7,8-tetrahydroquinazolin-2-amine.
| Compound Name | 4-butoxy-5,6,7,8-tetrahydroquinazolin-2-amine |
|---|---|
| PubChem CID | 57000786 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 4-butoxy-5,6,7,8-tetrahydroquinazolin-2-amine |
| SMILES | CCCCOc1nc(N)nc2c1CCCC2 |
| InChI | InChI=1S/C12H19N3O/c1-2-3-8-16-11-9-6-4-5-7-10(9)14-12(13)15-11/h2-8H2,1H3,(H2,13,14,15) |
| InChIKey | VCXFYGSKKCGDDJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|