C21H29NO — CID 57000793
7-(5,5,6,7-tetramethyloct-3-enyl)quinolin-8-ol (PubChem CID 57000793) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is 7-(5,5,6,7-tetramethyloct-3-enyl)quinolin-8-ol.
| Compound Name | 7-(5,5,6,7-tetramethyloct-3-enyl)quinolin-8-ol |
|---|---|
| PubChem CID | 57000793 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 7-(5,5,6,7-tetramethyloct-3-enyl)quinolin-8-ol |
| SMILES | CC(C)C(C)C(C)(C)C=CCCc1ccc2cccnc2c1O |
| InChI | InChI=1S/C21H29NO/c1-15(2)16(3)21(4,5)13-7-6-9-18-12-11-17-10-8-14-22-19(17)20(18)23/h7-8,10-16,23H,6,9H2,1-5H3 |
| InChIKey | BJTYQBIWHLINRS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|