C4H2Cl4F4 — CID 57001137
1,2,3,4-tetrachloro-1,1,2,4-tetrafluorobutane (PubChem CID 57001137) has the molecular formula C4H2Cl4F4 and a molecular weight of 267.86 g/mol. Its IUPAC name is 1,2,3,4-tetrachloro-1,1,2,4-tetrafluorobutane.
| Compound Name | 1,2,3,4-tetrachloro-1,1,2,4-tetrafluorobutane |
|---|---|
| PubChem CID | 57001137 |
| Molecular Formula | C4H2Cl4F4 |
| Molecular Weight | 267.86 g/mol |
| Exact Mass | 265.88 |
| IUPAC Name | 1,2,3,4-tetrachloro-1,1,2,4-tetrafluorobutane |
| SMILES | FC(Cl)C(Cl)C(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C4H2Cl4F4/c5-1(2(6)9)3(7,10)4(8,11)12/h1-2H |
| InChIKey | AOCHULOUQLWOMR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.86 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|