About 2,4,4-triphenyl-5H-1,3-oxazin-6-one
2,4,4-triphenyl-5H-1,3-oxazin-6-one (PubChem CID 570014) has the molecular formula C22H17NO2
and a molecular weight of 327.38 g/mol. Its IUPAC name is 2,4,4-triphenyl-5H-1,3-oxazin-6-one.
Molecular Properties
| Compound Name | 2,4,4-triphenyl-5H-1,3-oxazin-6-one |
| PubChem CID | 570014 |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2,4,4-triphenyl-5H-1,3-oxazin-6-one |
| SMILES | O=C1CC(c2ccccc2)(c2ccccc2)N=C(c2ccccc2)O1 |
| InChI | InChI=1S/C22H17NO2/c24-20-16-22(18-12-6-2-7-13-18,19-14-8-3-9-15-19)23-21(25-20)17-10-4-1-5-11-17/h1-15H,16H2 |
| InChIKey | RZQDWCNHNBDZHI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4,4-triphenyl-5H-1,3-oxazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,4-triphenyl-5H-1,3-oxazin-6-one?
The IUPAC name of 2,4,4-triphenyl-5H-1,3-oxazin-6-one (CID 570014) is 2,4,4-triphenyl-5H-1,3-oxazin-6-one.
What is the SMILES notation for 2,4,4-triphenyl-5H-1,3-oxazin-6-one?
The canonical SMILES for 2,4,4-triphenyl-5H-1,3-oxazin-6-one is O=C1CC(c2ccccc2)(c2ccccc2)N=C(c2ccccc2)O1.
What is the InChIKey of 2,4,4-triphenyl-5H-1,3-oxazin-6-one?
The InChIKey is RZQDWCNHNBDZHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17NO2/c24-20-16-22(18-12-6-2-7-13-18,19-14-8-3-9-15-19)23-21(25-20)17-10-4-1-5-11-17/h1-15H,16H2.
What are the key properties of 2,4,4-triphenyl-5H-1,3-oxazin-6-one?
2,4,4-triphenyl-5H-1,3-oxazin-6-one has a molecular weight of 327.38 g/mol, XLogP of 4.32, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,4-triphenyl-5H-1,3-oxazin-6-one is sourced from PubChem (CID 570014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).