About 1-methyl-4-nitro-2,3-dihydropyrrole
1-methyl-4-nitro-2,3-dihydropyrrole (PubChem CID 57001476) has the molecular formula C5H8N2O2
and a molecular weight of 128.13 g/mol. Its IUPAC name is 1-methyl-4-nitro-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | 1-methyl-4-nitro-2,3-dihydropyrrole |
| PubChem CID | 57001476 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 1-methyl-4-nitro-2,3-dihydropyrrole |
| SMILES | CN1C=C([N+](=O)[O-])CC1 |
| InChI | InChI=1S/C5H8N2O2/c1-6-3-2-5(4-6)7(8)9/h4H,2-3H2,1H3 |
| InChIKey | CLOOZUBVAWJWBE-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-nitro-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-nitro-2,3-dihydropyrrole?
The IUPAC name of 1-methyl-4-nitro-2,3-dihydropyrrole (CID 57001476) is 1-methyl-4-nitro-2,3-dihydropyrrole.
What is the SMILES notation for 1-methyl-4-nitro-2,3-dihydropyrrole?
The canonical SMILES for 1-methyl-4-nitro-2,3-dihydropyrrole is CN1C=C([N+](=O)[O-])CC1.
What is the InChIKey of 1-methyl-4-nitro-2,3-dihydropyrrole?
The InChIKey is CLOOZUBVAWJWBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2/c1-6-3-2-5(4-6)7(8)9/h4H,2-3H2,1H3.
What are the key properties of 1-methyl-4-nitro-2,3-dihydropyrrole?
1-methyl-4-nitro-2,3-dihydropyrrole has a molecular weight of 128.13 g/mol, XLogP of 0.44, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-nitro-2,3-dihydropyrrole is sourced from PubChem (CID 57001476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).