C22H29N4O2+ — CID 57001497
(6aR,9R)-9-(hydroxymethyl)-5-[(4-methylmorpholin-4-ium-4-yl)methyl]-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-7-carbonitrile (PubChem CID 57001497) has the molecular formula C22H29N4O2+ and a molecular weight of 381.50 g/mol. Its IUPAC name is (6aR,9R)-9-(hydroxymethyl)-5-[(4-methylmorpholin-4-ium-4-yl)methyl]-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-7-carbonitrile.
| Compound Name | (6aR,9R)-9-(hydroxymethyl)-5-[(4-methylmorpholin-4-ium-4-yl)methyl]-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-7-carbonitrile |
|---|---|
| PubChem CID | 57001497 |
| Molecular Formula | C22H29N4O2+ |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (6aR,9R)-9-(hydroxymethyl)-5-[(4-methylmorpholin-4-ium-4-yl)methyl]-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-7-carbonitrile |
| SMILES | C[N+]1(Cc2[nH]c3cccc4c3c2C[C@@H]2C4C[C@@H](CO)CN2C#N)CCOCC1 |
| InChI | InChI=1S/C22H29N4O2/c1-26(5-7-28-8-6-26)12-20-18-10-21-17(9-15(13-27)11-25(21)14-23)16-3-2-4-19(24-20)22(16)18/h2-4,15,17,21,24,27H,5-13H2,1H3/q+1/t15-,17?,21-/m1/s1 |
| InChIKey | SRYFUBOJTSHKAP-IKZMBGHXSA-N |
| XLogP | 1.95 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|