C20H24O3 — CID 57001822
(8'S,13'S,14'S)-2'-methylspiro[1,3-dioxolane-2,3'-2,6,7,8,13,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene]-17'-one (PubChem CID 57001822) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is (8'S,13'S,14'S)-2'-methylspiro[1,3-dioxolane-2,3'-2,6,7,8,13,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene]-17'-one.
| Compound Name | (8'S,13'S,14'S)-2'-methylspiro[1,3-dioxolane-2,3'-2,6,7,8,13,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
|---|---|
| PubChem CID | 57001822 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (8'S,13'S,14'S)-2'-methylspiro[1,3-dioxolane-2,3'-2,6,7,8,13,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
| SMILES | CC1CC2=C3C=C[C@@H]4C(=O)CC[C@H]4[C@@H]3CCC2=CC12OCCO2 |
| InChI | InChI=1S/C20H24O3/c1-12-10-18-13(11-20(12)22-8-9-23-20)2-3-14-15-6-7-19(21)17(15)5-4-16(14)18/h4-5,11-12,14-15,17H,2-3,6-10H2,1H3/t12?,14-,15-,17-/m0/s1 |
| InChIKey | LBQIOHSYRHVJRI-KVWIOTKGSA-N |
| XLogP | 3.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |