About 3,7-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dienal
3,7-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dienal (PubChem CID 57002090) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is 3,7-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dienal.
Molecular Properties
| Compound Name | 3,7-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dienal |
| PubChem CID | 57002090 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 3,7-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dienal |
| SMILES | C=CCN(C)CC(C)=CCCC(C)=CC=O |
| InChI | InChI=1S/C14H23NO/c1-5-10-15(4)12-14(3)8-6-7-13(2)9-11-16/h5,8-9,11H,1,6-7,10,12H2,2-4H3 |
| InChIKey | LBPKQXPZDIMPJB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dienal?
The IUPAC name of 3,7-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dienal (CID 57002090) is 3,7-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dienal.
What is the SMILES notation for 3,7-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dienal?
The canonical SMILES for 3,7-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dienal is C=CCN(C)CC(C)=CCCC(C)=CC=O.
What is the InChIKey of 3,7-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dienal?
The InChIKey is LBPKQXPZDIMPJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO/c1-5-10-15(4)12-14(3)8-6-7-13(2)9-11-16/h5,8-9,11H,1,6-7,10,12H2,2-4H3.
What are the key properties of 3,7-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dienal?
3,7-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dienal has a molecular weight of 221.34 g/mol, XLogP of 2.98, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-8-[methyl(prop-2-enyl)amino]octa-2,6-dienal is sourced from PubChem (CID 57002090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).