C18H28O3 — CID 57002134
2,6-dimethyl-1-(oxan-2-yl)undeca-2,6-diene-1,10-dione (PubChem CID 57002134) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2,6-dimethyl-1-(oxan-2-yl)undeca-2,6-diene-1,10-dione.
| Compound Name | 2,6-dimethyl-1-(oxan-2-yl)undeca-2,6-diene-1,10-dione |
|---|---|
| PubChem CID | 57002134 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2,6-dimethyl-1-(oxan-2-yl)undeca-2,6-diene-1,10-dione |
| SMILES | CC(=O)CCC=C(C)CCC=C(C)C(=O)C1CCCCO1 |
| InChI | InChI=1S/C18H28O3/c1-14(9-7-11-16(3)19)8-6-10-15(2)18(20)17-12-4-5-13-21-17/h9-10,17H,4-8,11-13H2,1-3H3 |
| InChIKey | YZTGUACKJNDCRJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|