About N-tert-butyl-N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide
N-tert-butyl-N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide (PubChem CID 57002219) has the molecular formula C16H16Cl2N2O2S
and a molecular weight of 371.29 g/mol. Its IUPAC name is N-tert-butyl-N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide.
Molecular Properties
| Compound Name | N-tert-butyl-N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide |
| PubChem CID | 57002219 |
| Molecular Formula | C16H16Cl2N2O2S |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | N-tert-butyl-N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide |
| SMILES | CC(C)(C)N(NC(=O)c1ccc(Cl)c(Cl)c1)C(=O)c1cccs1 |
| InChI | InChI=1S/C16H16Cl2N2O2S/c1-16(2,3)20(15(22)13-5-4-8-23-13)19-14(21)10-6-7-11(17)12(18)9-10/h4-9H,1-3H3,(H,19,21) |
| InChIKey | NJWYIYZJFHSQPK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide?
The IUPAC name of N-tert-butyl-N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide (CID 57002219) is N-tert-butyl-N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide.
What is the SMILES notation for N-tert-butyl-N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide?
The canonical SMILES for N-tert-butyl-N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide is CC(C)(C)N(NC(=O)c1ccc(Cl)c(Cl)c1)C(=O)c1cccs1.
What is the InChIKey of N-tert-butyl-N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide?
The InChIKey is NJWYIYZJFHSQPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Cl2N2O2S/c1-16(2,3)20(15(22)13-5-4-8-23-13)19-14(21)10-6-7-11(17)12(18)9-10/h4-9H,1-3H3,(H,19,21).
What are the key properties of N-tert-butyl-N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide?
N-tert-butyl-N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide has a molecular weight of 371.29 g/mol, XLogP of 4.64, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide is sourced from PubChem (CID 57002219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).