C24H29NO2S — CID 57002272
methyl 5-[4-(4-butylphenyl)-3-(1H-pyrrol-2-yl)butyl]thiophene-2-carboxylate (PubChem CID 57002272) has the molecular formula C24H29NO2S and a molecular weight of 395.57 g/mol. Its IUPAC name is methyl 5-[4-(4-butylphenyl)-3-(1H-pyrrol-2-yl)butyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[4-(4-butylphenyl)-3-(1H-pyrrol-2-yl)butyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 57002272 |
| Molecular Formula | C24H29NO2S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | methyl 5-[4-(4-butylphenyl)-3-(1H-pyrrol-2-yl)butyl]thiophene-2-carboxylate |
| SMILES | CCCCc1ccc(CC(CCc2ccc(C(=O)OC)s2)c2ccc[nH]2)cc1 |
| InChI | InChI=1S/C24H29NO2S/c1-3-4-6-18-8-10-19(11-9-18)17-20(22-7-5-16-25-22)12-13-21-14-15-23(28-21)24(26)27-2/h5,7-11,14-16,20,25H,3-4,6,12-13,17H2,1-2H3 |
| InChIKey | WXTDEUYEMLYABJ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |