C22H38N2O5 — CID 57002493
cyclopentyl (2S)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate (PubChem CID 57002493) has the molecular formula C22H38N2O5 and a molecular weight of 410.56 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate.
| Compound Name | cyclopentyl (2S)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 57002493 |
| Molecular Formula | C22H38N2O5 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | cyclopentyl (2S)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate |
| SMILES | C=CC[C@H](C(=O)NO)[C@@H](CC(C)C)C(=O)N[C@H](C(=O)OC1CCCC1)C(C)(C)C |
| InChI | InChI=1S/C22H38N2O5/c1-7-10-16(20(26)24-28)17(13-14(2)3)19(25)23-18(22(4,5)6)21(27)29-15-11-8-9-12-15/h7,14-18,28H,1,8-13H2,2-6H3,(H,23,25)(H,24,26)/t16-,17+,18+/m0/s1 |
| InChIKey | ORBFGCDUALWZFX-RCCFBDPRSA-N |
| XLogP | 3.36 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|