C26H34O2 — CID 57002776
3-methyl-4-[5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-2-bicyclo[3.1.0]hexanylidene]but-2-enoic acid (PubChem CID 57002776) has the molecular formula C26H34O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 3-methyl-4-[5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-2-bicyclo[3.1.0]hexanylidene]but-2-enoic acid.
| Compound Name | 3-methyl-4-[5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-2-bicyclo[3.1.0]hexanylidene]but-2-enoic acid |
|---|---|
| PubChem CID | 57002776 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 3-methyl-4-[5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-2-bicyclo[3.1.0]hexanylidene]but-2-enoic acid |
| SMILES | CC(=CC(=O)O)C=C1CCC2(c3cc4c(cc3C)C(C)(C)CCC4(C)C)CC12 |
| InChI | InChI=1S/C26H34O2/c1-16(12-23(27)28)11-18-7-8-26(15-22(18)26)19-14-21-20(13-17(19)2)24(3,4)9-10-25(21,5)6/h11-14,22H,7-10,15H2,1-6H3,(H,27,28) |
| InChIKey | ZPJOHBXGVITPHR-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|