C11H9N3O — CID 57002878
3-(1-methylindol-2-yl)-1,2,4-oxadiazole (PubChem CID 57002878) has the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. Its IUPAC name is 3-(1-methylindol-2-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(1-methylindol-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 57002878 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 3-(1-methylindol-2-yl)-1,2,4-oxadiazole |
| SMILES | Cn1c(-c2ncon2)cc2ccccc21 |
| InChI | InChI=1S/C11H9N3O/c1-14-9-5-3-2-4-8(9)6-10(14)11-12-7-15-13-11/h2-7H,1H3 |
| InChIKey | ILBMXPUQTULSER-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |