About [3-(1,3-benzodioxol-5-yl)-4-methyl-1H-pyrrolo[3,2-b]indol-2-yl] ethyl carbonate
[3-(1,3-benzodioxol-5-yl)-4-methyl-1H-pyrrolo[3,2-b]indol-2-yl] ethyl carbonate (PubChem CID 57002884) has the molecular formula C21H18N2O5
and a molecular weight of 378.38 g/mol. Its IUPAC name is [3-(1,3-benzodioxol-5-yl)-4-methyl-1H-pyrrolo[3,2-b]indol-2-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [3-(1,3-benzodioxol-5-yl)-4-methyl-1H-pyrrolo[3,2-b]indol-2-yl] ethyl carbonate |
| PubChem CID | 57002884 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | [3-(1,3-benzodioxol-5-yl)-4-methyl-1H-pyrrolo[3,2-b]indol-2-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1[nH]c2c3ccccc3n(C)c2c1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H18N2O5/c1-3-25-21(24)28-20-17(12-8-9-15-16(10-12)27-11-26-15)19-18(22-20)13-6-4-5-7-14(13)23(19)2/h4-10,22H,3,11H2,1-2H3 |
| InChIKey | QODAIPJEPNHHFT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-(1,3-benzodioxol-5-yl)-4-methyl-1H-pyrrolo[3,2-b]indol-2-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,3-benzodioxol-5-yl)-4-methyl-1H-pyrrolo[3,2-b]indol-2-yl] ethyl carbonate?
The IUPAC name of [3-(1,3-benzodioxol-5-yl)-4-methyl-1H-pyrrolo[3,2-b]indol-2-yl] ethyl carbonate (CID 57002884) is [3-(1,3-benzodioxol-5-yl)-4-methyl-1H-pyrrolo[3,2-b]indol-2-yl] ethyl carbonate.
What is the SMILES notation for [3-(1,3-benzodioxol-5-yl)-4-methyl-1H-pyrrolo[3,2-b]indol-2-yl] ethyl carbonate?
The canonical SMILES for [3-(1,3-benzodioxol-5-yl)-4-methyl-1H-pyrrolo[3,2-b]indol-2-yl] ethyl carbonate is CCOC(=O)Oc1[nH]c2c3ccccc3n(C)c2c1-c1ccc2c(c1)OCO2.
What is the InChIKey of [3-(1,3-benzodioxol-5-yl)-4-methyl-1H-pyrrolo[3,2-b]indol-2-yl] ethyl carbonate?
The InChIKey is QODAIPJEPNHHFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O5/c1-3-25-21(24)28-20-17(12-8-9-15-16(10-12)27-11-26-15)19-18(22-20)13-6-4-5-7-14(13)23(19)2/h4-10,22H,3,11H2,1-2H3.
What are the key properties of [3-(1,3-benzodioxol-5-yl)-4-methyl-1H-pyrrolo[3,2-b]indol-2-yl] ethyl carbonate?
[3-(1,3-benzodioxol-5-yl)-4-methyl-1H-pyrrolo[3,2-b]indol-2-yl] ethyl carbonate has a molecular weight of 378.38 g/mol, XLogP of 4.59, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,3-benzodioxol-5-yl)-4-methyl-1H-pyrrolo[3,2-b]indol-2-yl] ethyl carbonate is sourced from PubChem (CID 57002884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).