C21H29FO2 — CID 57002997
(1R,7R,8R,9S,10R,13S,14S)-7-(fluoromethyl)-1,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57002997) has the molecular formula C21H29FO2 and a molecular weight of 332.46 g/mol. Its IUPAC name is (1R,7R,8R,9S,10R,13S,14S)-7-(fluoromethyl)-1,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (1R,7R,8R,9S,10R,13S,14S)-7-(fluoromethyl)-1,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57002997 |
| Molecular Formula | C21H29FO2 |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | (1R,7R,8R,9S,10R,13S,14S)-7-(fluoromethyl)-1,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@@H]1CC(=O)C=C2C[C@@H](CF)[C@@H]3[C@H](CC[C@]4(C)C(=O)CC[C@@H]34)[C@]21C |
| InChI | InChI=1S/C21H29FO2/c1-12-8-15(23)10-14-9-13(11-22)19-16-4-5-18(24)20(16,2)7-6-17(19)21(12,14)3/h10,12-13,16-17,19H,4-9,11H2,1-3H3/t12-,13+,16+,17+,19+,20+,21+/m1/s1 |
| InChIKey | AUZLSRPBBKMZRR-FJICKFFVSA-N |
| XLogP | 4.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |