C17H26O3 — CID 57003054
5-(4,4-dimethoxybut-1-enyl)-8,8-dimethyl-1,5,6,7-tetrahydroisochromene (PubChem CID 57003054) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 5-(4,4-dimethoxybut-1-enyl)-8,8-dimethyl-1,5,6,7-tetrahydroisochromene.
| Compound Name | 5-(4,4-dimethoxybut-1-enyl)-8,8-dimethyl-1,5,6,7-tetrahydroisochromene |
|---|---|
| PubChem CID | 57003054 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 5-(4,4-dimethoxybut-1-enyl)-8,8-dimethyl-1,5,6,7-tetrahydroisochromene |
| SMILES | COC(CC=CC1CCC(C)(C)C2=C1C=COC2)OC |
| InChI | InChI=1S/C17H26O3/c1-17(2)10-8-13(6-5-7-16(18-3)19-4)14-9-11-20-12-15(14)17/h5-6,9,11,13,16H,7-8,10,12H2,1-4H3 |
| InChIKey | XZBRWXCZXPVYOZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|