C11H16O7 — CID 57003408
1-[(3R,4R,5S)-3,4-diacetyl-3,4,5-trihydroxyoxan-2-yl]ethanone (PubChem CID 57003408) has the molecular formula C11H16O7 and a molecular weight of 260.24 g/mol. Its IUPAC name is 1-[(3R,4R,5S)-3,4-diacetyl-3,4,5-trihydroxyoxan-2-yl]ethanone.
| Compound Name | 1-[(3R,4R,5S)-3,4-diacetyl-3,4,5-trihydroxyoxan-2-yl]ethanone |
|---|---|
| PubChem CID | 57003408 |
| Molecular Formula | C11H16O7 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 1-[(3R,4R,5S)-3,4-diacetyl-3,4,5-trihydroxyoxan-2-yl]ethanone |
| SMILES | CC(=O)C1OC[C@H](O)[C@](O)(C(C)=O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C11H16O7/c1-5(12)9-11(17,7(3)14)10(16,6(2)13)8(15)4-18-9/h8-9,15-17H,4H2,1-3H3/t8-,9?,10+,11+/m0/s1 |
| InChIKey | HPDVHFLRKFPBPG-PIOBBSKYSA-N |
| XLogP | -2.02 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |