C5H10O3S — CID 57003726
(4S,6S)-4,6-dimethyl-1,3,2-dioxathiane 2-oxide (PubChem CID 57003726) has the molecular formula C5H10O3S and a molecular weight of 150.20 g/mol. Its IUPAC name is (4S,6S)-4,6-dimethyl-1,3,2-dioxathiane 2-oxide.
| Compound Name | (4S,6S)-4,6-dimethyl-1,3,2-dioxathiane 2-oxide |
|---|---|
| PubChem CID | 57003726 |
| Molecular Formula | C5H10O3S |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | (4S,6S)-4,6-dimethyl-1,3,2-dioxathiane 2-oxide |
| SMILES | C[C@H]1C[C@H](C)OS(=O)O1 |
| InChI | InChI=1S/C5H10O3S/c1-4-3-5(2)8-9(6)7-4/h4-5H,3H2,1-2H3/t4-,5-/m0/s1 |
| InChIKey | USNQMYYMYHSTGH-WHFBIAKZSA-N |
| XLogP | 0.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |