C7H8F4N4O — CID 57003761
6-(2,2,3,3-tetrafluoropropoxy)pyrimidine-2,4-diamine (PubChem CID 57003761) has the molecular formula C7H8F4N4O and a molecular weight of 240.16 g/mol. Its IUPAC name is 6-(2,2,3,3-tetrafluoropropoxy)pyrimidine-2,4-diamine.
| Compound Name | 6-(2,2,3,3-tetrafluoropropoxy)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 57003761 |
| Molecular Formula | C7H8F4N4O |
| Molecular Weight | 240.16 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 6-(2,2,3,3-tetrafluoropropoxy)pyrimidine-2,4-diamine |
| SMILES | Nc1cc(OCC(F)(F)C(F)F)nc(N)n1 |
| InChI | InChI=1S/C7H8F4N4O/c8-5(9)7(10,11)2-16-4-1-3(12)14-6(13)15-4/h1,5H,2H2,(H4,12,13,14,15) |
| InChIKey | FXQNJYYLIRNVEZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.16 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|