methyl (2S)-2-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]butanoate

C11H20O4 — CID 57003809

IUPACmethyl (2S)-2-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]butanoate
SMILESCC[C@H](C(=O)OC)[C@]1(C)COC(C)(C)O1
InChIInChI=1S/C11H20O4/c1-6-8(9(12)13-5)11(4)7-14-10(2,3)15-11/h8H,6-7H2,1-5H3/t8-,11+/m1/s1
InChIKeyRMQBSDPQOONTHV-KCJUWKMLSA-N
MW216.28 g/mol
LogP1.73
Rot. Bonds3

About methyl (2S)-2-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]butanoate

methyl (2S)-2-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]butanoate (PubChem CID 57003809) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is methyl (2S)-2-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]butanoate.

Molecular Properties

Compound Namemethyl (2S)-2-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]butanoate
PubChem CID57003809
Molecular FormulaC11H20O4
Molecular Weight216.28 g/mol
Exact Mass216.14
IUPAC Namemethyl (2S)-2-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]butanoate
SMILESCC[C@H](C(=O)OC)[C@]1(C)COC(C)(C)O1
InChIInChI=1S/C11H20O4/c1-6-8(9(12)13-5)11(4)7-14-10(2,3)15-11/h8H,6-7H2,1-5H3/t8-,11+/m1/s1
InChIKeyRMQBSDPQOONTHV-KCJUWKMLSA-N
XLogP1.73
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.28
LogP ≤ 51.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl (2S)-2-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-2-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]butanoate?
The IUPAC name of methyl (2S)-2-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]butanoate (CID 57003809) is methyl (2S)-2-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]butanoate.
What is the SMILES notation for methyl (2S)-2-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]butanoate?
The canonical SMILES for methyl (2S)-2-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]butanoate is CC[C@H](C(=O)OC)[C@]1(C)COC(C)(C)O1.
What is the InChIKey of methyl (2S)-2-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]butanoate?
The InChIKey is RMQBSDPQOONTHV-KCJUWKMLSA-N. The full InChI is InChI=1S/C11H20O4/c1-6-8(9(12)13-5)11(4)7-14-10(2,3)15-11/h8H,6-7H2,1-5H3/t8-,11+/m1/s1.
What are the key properties of methyl (2S)-2-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]butanoate?
methyl (2S)-2-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]butanoate has a molecular weight of 216.28 g/mol, XLogP of 1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]butanoate is sourced from PubChem (CID 57003809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).