About 1-hydroxyhex-5-en-3-one
1-hydroxyhex-5-en-3-one (PubChem CID 57004068) has the molecular formula C6H10O2
and a molecular weight of 114.14 g/mol. Its IUPAC name is 1-hydroxyhex-5-en-3-one.
Molecular Properties
| Compound Name | 1-hydroxyhex-5-en-3-one |
| PubChem CID | 57004068 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 1-hydroxyhex-5-en-3-one |
| SMILES | C=CCC(=O)CCO |
| InChI | InChI=1S/C6H10O2/c1-2-3-6(8)4-5-7/h2,7H,1,3-5H2 |
| InChIKey | OXTSQHCPVVNEDH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyhex-5-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyhex-5-en-3-one?
The IUPAC name of 1-hydroxyhex-5-en-3-one (CID 57004068) is 1-hydroxyhex-5-en-3-one.
What is the SMILES notation for 1-hydroxyhex-5-en-3-one?
The canonical SMILES for 1-hydroxyhex-5-en-3-one is C=CCC(=O)CCO.
What is the InChIKey of 1-hydroxyhex-5-en-3-one?
The InChIKey is OXTSQHCPVVNEDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2/c1-2-3-6(8)4-5-7/h2,7H,1,3-5H2.
What are the key properties of 1-hydroxyhex-5-en-3-one?
1-hydroxyhex-5-en-3-one has a molecular weight of 114.14 g/mol, XLogP of 0.51, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyhex-5-en-3-one is sourced from PubChem (CID 57004068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).