About (1-hexoxycyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate
(1-hexoxycyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate (PubChem CID 57004109) has the molecular formula C26H37F3O3
and a molecular weight of 454.57 g/mol. Its IUPAC name is (1-hexoxycyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (1-hexoxycyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate |
| PubChem CID | 57004109 |
| Molecular Formula | C26H37F3O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (1-hexoxycyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCOC1(COC(=O)C2(c3cc(F)c(F)c(F)c3)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C26H37F3O3/c1-2-3-4-11-16-32-25(12-7-5-8-13-25)19-31-24(30)26(14-9-6-10-15-26)20-17-21(27)23(29)22(28)18-20/h17-18H,2-16,19H2,1H3 |
| InChIKey | XFRLTNBOLQXNEG-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze (1-hexoxycyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-hexoxycyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate?
The IUPAC name of (1-hexoxycyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate (CID 57004109) is (1-hexoxycyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate.
What is the SMILES notation for (1-hexoxycyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate?
The canonical SMILES for (1-hexoxycyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate is CCCCCCOC1(COC(=O)C2(c3cc(F)c(F)c(F)c3)CCCCC2)CCCCC1.
What is the InChIKey of (1-hexoxycyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate?
The InChIKey is XFRLTNBOLQXNEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H37F3O3/c1-2-3-4-11-16-32-25(12-7-5-8-13-25)19-31-24(30)26(14-9-6-10-15-26)20-17-21(27)23(29)22(28)18-20/h17-18H,2-16,19H2,1H3.
What are the key properties of (1-hexoxycyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate?
(1-hexoxycyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate has a molecular weight of 454.57 g/mol, XLogP of 7.15, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-hexoxycyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 57004109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).