About 2-[[3-(2,3-dimethoxyphenyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid
2-[[3-(2,3-dimethoxyphenyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid (PubChem CID 57004213) has the molecular formula C17H21NO6
and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-[[3-(2,3-dimethoxyphenyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid.
Molecular Properties
| Compound Name | 2-[[3-(2,3-dimethoxyphenyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid |
| PubChem CID | 57004213 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-[[3-(2,3-dimethoxyphenyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid |
| SMILES | COc1cccc(C2(OC(=O)C(=O)O)CN3CCC2CC3)c1OC |
| InChI | InChI=1S/C17H21NO6/c1-22-13-5-3-4-12(14(13)23-2)17(24-16(21)15(19)20)10-18-8-6-11(17)7-9-18/h3-5,11H,6-10H2,1-2H3,(H,19,20) |
| InChIKey | WHMKDIMBXDSYDA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3-(2,3-dimethoxyphenyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(2,3-dimethoxyphenyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid?
The IUPAC name of 2-[[3-(2,3-dimethoxyphenyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid (CID 57004213) is 2-[[3-(2,3-dimethoxyphenyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid.
What is the SMILES notation for 2-[[3-(2,3-dimethoxyphenyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid?
The canonical SMILES for 2-[[3-(2,3-dimethoxyphenyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid is COc1cccc(C2(OC(=O)C(=O)O)CN3CCC2CC3)c1OC.
What is the InChIKey of 2-[[3-(2,3-dimethoxyphenyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid?
The InChIKey is WHMKDIMBXDSYDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO6/c1-22-13-5-3-4-12(14(13)23-2)17(24-16(21)15(19)20)10-18-8-6-11(17)7-9-18/h3-5,11H,6-10H2,1-2H3,(H,19,20).
What are the key properties of 2-[[3-(2,3-dimethoxyphenyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid?
2-[[3-(2,3-dimethoxyphenyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid has a molecular weight of 335.36 g/mol, XLogP of 1.25, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(2,3-dimethoxyphenyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxoacetic acid is sourced from PubChem (CID 57004213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).