C16H25N5O — CID 57004578
1-[amino(piperidin-1-yl)methylidene]-3-[3-(3-methyl-2-pyridinyl)propyl]urea (PubChem CID 57004578) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[amino(piperidin-1-yl)methylidene]-3-[3-(3-methyl-2-pyridinyl)propyl]urea.
| Compound Name | 1-[amino(piperidin-1-yl)methylidene]-3-[3-(3-methyl-2-pyridinyl)propyl]urea |
|---|---|
| PubChem CID | 57004578 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | 1-[amino(piperidin-1-yl)methylidene]-3-[3-(3-methyl-2-pyridinyl)propyl]urea |
| SMILES | Cc1cccnc1CCCNC(=O)N=C(N)N1CCCCC1 |
| InChI | InChI=1S/C16H25N5O/c1-13-7-5-9-18-14(13)8-6-10-19-16(22)20-15(17)21-11-3-2-4-12-21/h5,7,9H,2-4,6,8,10-12H2,1H3,(H3,17,19,20,22) |
| InChIKey | KRMICUARXFQXQZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|