C28H50O7Si — CID 57004649
methyl 7-[(1R,2R,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(4R)-2-methyl-1,3-dioxolan-4-yl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 57004649) has the molecular formula C28H50O7Si and a molecular weight of 526.79 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(4R)-2-methyl-1,3-dioxolan-4-yl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(4R)-2-methyl-1,3-dioxolan-4-yl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 57004649 |
| Molecular Formula | C28H50O7Si |
| Molecular Weight | 526.79 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(4R)-2-methyl-1,3-dioxolan-4-yl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CC[C@@H]1[C@@H]([C@@H]2COC(C)O2)[C@H](OC2CCCCO2)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H50O7Si/c1-20-32-19-24(33-20)27-21(14-10-8-9-11-15-25(29)30-5)22(35-36(6,7)28(2,3)4)18-23(27)34-26-16-12-13-17-31-26/h8,10,20-24,26-27H,9,11-19H2,1-7H3/t20?,21-,22-,23+,24-,26?,27+/m0/s1 |
| InChIKey | GPTMOQYQIAKJTK-GRXBEXFWSA-N |
| XLogP | 5.98 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.79 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|