About 6-methyl-5-phenyl-2,3-dihydro-1,4-oxathiine-2-carboxamide
6-methyl-5-phenyl-2,3-dihydro-1,4-oxathiine-2-carboxamide (PubChem CID 57005004) has the molecular formula C12H13NO2S
and a molecular weight of 235.31 g/mol. Its IUPAC name is 6-methyl-5-phenyl-2,3-dihydro-1,4-oxathiine-2-carboxamide.
Molecular Properties
| Compound Name | 6-methyl-5-phenyl-2,3-dihydro-1,4-oxathiine-2-carboxamide |
| PubChem CID | 57005004 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 6-methyl-5-phenyl-2,3-dihydro-1,4-oxathiine-2-carboxamide |
| SMILES | CC1=C(c2ccccc2)SCC(C(N)=O)O1 |
| InChI | InChI=1S/C12H13NO2S/c1-8-11(9-5-3-2-4-6-9)16-7-10(15-8)12(13)14/h2-6,10H,7H2,1H3,(H2,13,14) |
| InChIKey | DFMDYXIUQNHKQQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-5-phenyl-2,3-dihydro-1,4-oxathiine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5-phenyl-2,3-dihydro-1,4-oxathiine-2-carboxamide?
The IUPAC name of 6-methyl-5-phenyl-2,3-dihydro-1,4-oxathiine-2-carboxamide (CID 57005004) is 6-methyl-5-phenyl-2,3-dihydro-1,4-oxathiine-2-carboxamide.
What is the SMILES notation for 6-methyl-5-phenyl-2,3-dihydro-1,4-oxathiine-2-carboxamide?
The canonical SMILES for 6-methyl-5-phenyl-2,3-dihydro-1,4-oxathiine-2-carboxamide is CC1=C(c2ccccc2)SCC(C(N)=O)O1.
What is the InChIKey of 6-methyl-5-phenyl-2,3-dihydro-1,4-oxathiine-2-carboxamide?
The InChIKey is DFMDYXIUQNHKQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2S/c1-8-11(9-5-3-2-4-6-9)16-7-10(15-8)12(13)14/h2-6,10H,7H2,1H3,(H2,13,14).
What are the key properties of 6-methyl-5-phenyl-2,3-dihydro-1,4-oxathiine-2-carboxamide?
6-methyl-5-phenyl-2,3-dihydro-1,4-oxathiine-2-carboxamide has a molecular weight of 235.31 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5-phenyl-2,3-dihydro-1,4-oxathiine-2-carboxamide is sourced from PubChem (CID 57005004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).