C14H20F3N5OS2 — CID 57005173
4-N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-N-(2,2,2-trifluoroethyl)-1,2,5-thiadiazole-3,4-diamine (PubChem CID 57005173) has the molecular formula C14H20F3N5OS2 and a molecular weight of 395.48 g/mol. Its IUPAC name is 4-N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-N-(2,2,2-trifluoroethyl)-1,2,5-thiadiazole-3,4-diamine.
| Compound Name | 4-N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-N-(2,2,2-trifluoroethyl)-1,2,5-thiadiazole-3,4-diamine |
|---|---|
| PubChem CID | 57005173 |
| Molecular Formula | C14H20F3N5OS2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 4-N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-N-(2,2,2-trifluoroethyl)-1,2,5-thiadiazole-3,4-diamine |
| SMILES | CN(C)Cc1ccc(CSCCNc2nsnc2NCC(F)(F)F)o1 |
| InChI | InChI=1S/C14H20F3N5OS2/c1-22(2)7-10-3-4-11(23-10)8-24-6-5-18-12-13(21-25-20-12)19-9-14(15,16)17/h3-4H,5-9H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | LVJMLNSVWCLDLD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|