About 2-hydroxyheptanamide
2-hydroxyheptanamide (PubChem CID 57005484) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is 2-hydroxyheptanamide.
Molecular Properties
| Compound Name | 2-hydroxyheptanamide |
| PubChem CID | 57005484 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | 2-hydroxyheptanamide |
| SMILES | CCCCCC(O)C(N)=O |
| InChI | InChI=1S/C7H15NO2/c1-2-3-4-5-6(9)7(8)10/h6,9H,2-5H2,1H3,(H2,8,10) |
| InChIKey | UASBPOOBTIHEPT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyheptanamide?
The IUPAC name of 2-hydroxyheptanamide (CID 57005484) is 2-hydroxyheptanamide.
What is the SMILES notation for 2-hydroxyheptanamide?
The canonical SMILES for 2-hydroxyheptanamide is CCCCCC(O)C(N)=O.
What is the InChIKey of 2-hydroxyheptanamide?
The InChIKey is UASBPOOBTIHEPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2/c1-2-3-4-5-6(9)7(8)10/h6,9H,2-5H2,1H3,(H2,8,10).
What are the key properties of 2-hydroxyheptanamide?
2-hydroxyheptanamide has a molecular weight of 145.20 g/mol, XLogP of 0.41, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyheptanamide is sourced from PubChem (CID 57005484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).