About 3-(2,4-ditert-butylphenoxy)benzene-1,2-dicarbonitrile
3-(2,4-ditert-butylphenoxy)benzene-1,2-dicarbonitrile (PubChem CID 57005555) has the molecular formula C22H24N2O
and a molecular weight of 332.45 g/mol. Its IUPAC name is 3-(2,4-ditert-butylphenoxy)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 3-(2,4-ditert-butylphenoxy)benzene-1,2-dicarbonitrile |
| PubChem CID | 57005555 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 3-(2,4-ditert-butylphenoxy)benzene-1,2-dicarbonitrile |
| SMILES | CC(C)(C)c1ccc(Oc2cccc(C#N)c2C#N)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H24N2O/c1-21(2,3)16-10-11-20(18(12-16)22(4,5)6)25-19-9-7-8-15(13-23)17(19)14-24/h7-12H,1-6H3 |
| InChIKey | DYPXTZZWARULIX-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,4-ditert-butylphenoxy)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-ditert-butylphenoxy)benzene-1,2-dicarbonitrile?
The IUPAC name of 3-(2,4-ditert-butylphenoxy)benzene-1,2-dicarbonitrile (CID 57005555) is 3-(2,4-ditert-butylphenoxy)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 3-(2,4-ditert-butylphenoxy)benzene-1,2-dicarbonitrile?
The canonical SMILES for 3-(2,4-ditert-butylphenoxy)benzene-1,2-dicarbonitrile is CC(C)(C)c1ccc(Oc2cccc(C#N)c2C#N)c(C(C)(C)C)c1.
What is the InChIKey of 3-(2,4-ditert-butylphenoxy)benzene-1,2-dicarbonitrile?
The InChIKey is DYPXTZZWARULIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O/c1-21(2,3)16-10-11-20(18(12-16)22(4,5)6)25-19-9-7-8-15(13-23)17(19)14-24/h7-12H,1-6H3.
What are the key properties of 3-(2,4-ditert-butylphenoxy)benzene-1,2-dicarbonitrile?
3-(2,4-ditert-butylphenoxy)benzene-1,2-dicarbonitrile has a molecular weight of 332.45 g/mol, XLogP of 5.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-ditert-butylphenoxy)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 57005555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).