C30H64O5Si2 — CID 57005796
(2R,4S,5R,6S,8R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethoxy-2,8-dimethyl-9-tri(propan-2-yl)silyloxyundecanal (PubChem CID 57005796) has the molecular formula C30H64O5Si2 and a molecular weight of 561.01 g/mol. Its IUPAC name is (2R,4S,5R,6S,8R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethoxy-2,8-dimethyl-9-tri(propan-2-yl)silyloxyundecanal.
| Compound Name | (2R,4S,5R,6S,8R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethoxy-2,8-dimethyl-9-tri(propan-2-yl)silyloxyundecanal |
|---|---|
| PubChem CID | 57005796 |
| Molecular Formula | C30H64O5Si2 |
| Molecular Weight | 561.01 g/mol |
| Exact Mass | 560.43 |
| IUPAC Name | (2R,4S,5R,6S,8R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethoxy-2,8-dimethyl-9-tri(propan-2-yl)silyloxyundecanal |
| SMILES | CCC(O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)C[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C[C@@H](C)C=O)OC |
| InChI | InChI=1S/C30H64O5Si2/c1-17-26(34-37(21(2)3,22(4)5)23(6)7)25(9)19-28(33-14)29(27(32-13)18-24(8)20-31)35-36(15,16)30(10,11)12/h20-29H,17-19H2,1-16H3/t24-,25-,26?,27+,28+,29+/m1/s1 |
| InChIKey | CUTPGEIEDZBSMK-OLAHTZPUSA-N |
| XLogP | 8.63 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.01 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|