About 11-methylsulfonyl-6,11-dihydrobenzo[c][1]benzoxepine
11-methylsulfonyl-6,11-dihydrobenzo[c][1]benzoxepine (PubChem CID 57006154) has the molecular formula C15H14O3S
and a molecular weight of 274.34 g/mol. Its IUPAC name is 11-methylsulfonyl-6,11-dihydrobenzo[c][1]benzoxepine.
Molecular Properties
| Compound Name | 11-methylsulfonyl-6,11-dihydrobenzo[c][1]benzoxepine |
| PubChem CID | 57006154 |
| Molecular Formula | C15H14O3S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 11-methylsulfonyl-6,11-dihydrobenzo[c][1]benzoxepine |
| SMILES | CS(=O)(=O)C1c2ccccc2COc2ccccc21 |
| InChI | InChI=1S/C15H14O3S/c1-19(16,17)15-12-7-3-2-6-11(12)10-18-14-9-5-4-8-13(14)15/h2-9,15H,10H2,1H3 |
| InChIKey | KIQQIAZTDAWGAO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 11-methylsulfonyl-6,11-dihydrobenzo[c][1]benzoxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methylsulfonyl-6,11-dihydrobenzo[c][1]benzoxepine?
The IUPAC name of 11-methylsulfonyl-6,11-dihydrobenzo[c][1]benzoxepine (CID 57006154) is 11-methylsulfonyl-6,11-dihydrobenzo[c][1]benzoxepine.
What is the SMILES notation for 11-methylsulfonyl-6,11-dihydrobenzo[c][1]benzoxepine?
The canonical SMILES for 11-methylsulfonyl-6,11-dihydrobenzo[c][1]benzoxepine is CS(=O)(=O)C1c2ccccc2COc2ccccc21.
What is the InChIKey of 11-methylsulfonyl-6,11-dihydrobenzo[c][1]benzoxepine?
The InChIKey is KIQQIAZTDAWGAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O3S/c1-19(16,17)15-12-7-3-2-6-11(12)10-18-14-9-5-4-8-13(14)15/h2-9,15H,10H2,1H3.
What are the key properties of 11-methylsulfonyl-6,11-dihydrobenzo[c][1]benzoxepine?
11-methylsulfonyl-6,11-dihydrobenzo[c][1]benzoxepine has a molecular weight of 274.34 g/mol, XLogP of 2.71, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methylsulfonyl-6,11-dihydrobenzo[c][1]benzoxepine is sourced from PubChem (CID 57006154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).