C15H26O3 — CID 57006238
1-prop-1-enoxy-2,2-bis(prop-1-enoxymethyl)butane (PubChem CID 57006238) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 1-prop-1-enoxy-2,2-bis(prop-1-enoxymethyl)butane.
| Compound Name | 1-prop-1-enoxy-2,2-bis(prop-1-enoxymethyl)butane |
|---|---|
| PubChem CID | 57006238 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 1-prop-1-enoxy-2,2-bis(prop-1-enoxymethyl)butane |
| SMILES | CC=COCC(CC)(COC=CC)COC=CC |
| InChI | InChI=1S/C15H26O3/c1-5-9-16-12-15(8-4,13-17-10-6-2)14-18-11-7-3/h5-7,9-11H,8,12-14H2,1-4H3 |
| InChIKey | LQYSBSJOLPSPRC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|