C17H19NO2 — CID 57006302
1-[9-(methoxymethylidene)-1,2,4,10-tetrahydrobenzo[f]isoquinolin-3-yl]ethanone (PubChem CID 57006302) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-[9-(methoxymethylidene)-1,2,4,10-tetrahydrobenzo[f]isoquinolin-3-yl]ethanone.
| Compound Name | 1-[9-(methoxymethylidene)-1,2,4,10-tetrahydrobenzo[f]isoquinolin-3-yl]ethanone |
|---|---|
| PubChem CID | 57006302 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-[9-(methoxymethylidene)-1,2,4,10-tetrahydrobenzo[f]isoquinolin-3-yl]ethanone |
| SMILES | COC=C1C=Cc2ccc3c(c2C1)CCN(C(C)=O)C3 |
| InChI | InChI=1S/C17H19NO2/c1-12(19)18-8-7-16-15(10-18)6-5-14-4-3-13(11-20-2)9-17(14)16/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | BWZWJHYDXRXLNC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|