C26H32N6OSSi — CID 57006401
[tert-butyl(diphenyl)silyl]-[(2R,5S)-5-(2,6-diaminopurin-9-yl)thiolan-2-yl]methanol (PubChem CID 57006401) has the molecular formula C26H32N6OSSi and a molecular weight of 504.74 g/mol. Its IUPAC name is [tert-butyl(diphenyl)silyl]-[(2R,5S)-5-(2,6-diaminopurin-9-yl)thiolan-2-yl]methanol.
| Compound Name | [tert-butyl(diphenyl)silyl]-[(2R,5S)-5-(2,6-diaminopurin-9-yl)thiolan-2-yl]methanol |
|---|---|
| PubChem CID | 57006401 |
| Molecular Formula | C26H32N6OSSi |
| Molecular Weight | 504.74 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | [tert-butyl(diphenyl)silyl]-[(2R,5S)-5-(2,6-diaminopurin-9-yl)thiolan-2-yl]methanol |
| SMILES | CC(C)(C)[Si](c1ccccc1)(c1ccccc1)C(O)[C@H]1CC[C@@H](n2cnc3c(N)nc(N)nc32)S1 |
| InChI | InChI=1S/C26H32N6OSSi/c1-26(2,3)35(17-10-6-4-7-11-17,18-12-8-5-9-13-18)24(33)19-14-15-20(34-19)32-16-29-21-22(27)30-25(28)31-23(21)32/h4-13,16,19-20,24,33H,14-15H2,1-3H3,(H4,27,28,30,31)/t19-,20+,24?/m1/s1 |
| InChIKey | KGPNAWZPXRHMKF-HVUWCZLESA-N |
| XLogP | 3.35 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.74 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|