C15H22OS — CID 57006800
(5R)-2,2,4-trimethyl-5-propylsulfanyl-5,6-dihydrochromene (PubChem CID 57006800) has the molecular formula C15H22OS and a molecular weight of 250.41 g/mol. Its IUPAC name is (5R)-2,2,4-trimethyl-5-propylsulfanyl-5,6-dihydrochromene.
| Compound Name | (5R)-2,2,4-trimethyl-5-propylsulfanyl-5,6-dihydrochromene |
|---|---|
| PubChem CID | 57006800 |
| Molecular Formula | C15H22OS |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (5R)-2,2,4-trimethyl-5-propylsulfanyl-5,6-dihydrochromene |
| SMILES | CCCS[C@@H]1CC=CC2=C1C(C)=CC(C)(C)O2 |
| InChI | InChI=1S/C15H22OS/c1-5-9-17-13-8-6-7-12-14(13)11(2)10-15(3,4)16-12/h6-7,10,13H,5,8-9H2,1-4H3/t13-/m1/s1 |
| InChIKey | MDHHICHBAUZSIS-CYBMUJFWSA-N |
| XLogP | 4.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |