C19H28O3 — CID 57006962
(5aS,7R,9aR)-7-butyl-3-propyl-6,8,9,9a-tetrahydro-5aH-dibenzofuran-2,7-diol (PubChem CID 57006962) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (5aS,7R,9aR)-7-butyl-3-propyl-6,8,9,9a-tetrahydro-5aH-dibenzofuran-2,7-diol.
| Compound Name | (5aS,7R,9aR)-7-butyl-3-propyl-6,8,9,9a-tetrahydro-5aH-dibenzofuran-2,7-diol |
|---|---|
| PubChem CID | 57006962 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (5aS,7R,9aR)-7-butyl-3-propyl-6,8,9,9a-tetrahydro-5aH-dibenzofuran-2,7-diol |
| SMILES | CCCC[C@@]1(O)CC[C@@H]2c3cc(O)c(CCC)cc3O[C@H]2C1 |
| InChI | InChI=1S/C19H28O3/c1-3-5-8-19(21)9-7-14-15-11-16(20)13(6-4-2)10-17(15)22-18(14)12-19/h10-11,14,18,20-21H,3-9,12H2,1-2H3/t14-,18+,19-/m1/s1 |
| InChIKey | ZKDKFRGYOHMGEW-MDASCCDHSA-N |
| XLogP | 4.29 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |