C18H14N2O3 — CID 570072
N-(2,4-dihydroxy-3-methylnaphthalen-1-yl)iminobenzamide (PubChem CID 570072) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is N-(2,4-dihydroxy-3-methylnaphthalen-1-yl)iminobenzamide.
| Compound Name | N-(2,4-dihydroxy-3-methylnaphthalen-1-yl)iminobenzamide |
|---|---|
| PubChem CID | 570072 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-(2,4-dihydroxy-3-methylnaphthalen-1-yl)iminobenzamide |
| SMILES | Cc1c(O)c(/N=N/C(=O)c2ccccc2)c2ccccc2c1O |
| InChI | InChI=1S/C18H14N2O3/c1-11-16(21)14-10-6-5-9-13(14)15(17(11)22)19-20-18(23)12-7-3-2-4-8-12/h2-10,21-22H,1H3/b20-19+ |
| InChIKey | VIXLMJFUKSDSBO-FMQUCBEESA-N |
| XLogP | 4.48 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|