C16H21ClN2O3S — CID 57007246
tert-butyl 4-(3-chlorophenyl)-5-oxo-2-(sulfanylmethyl)piperazine-1-carboxylate (PubChem CID 57007246) has the molecular formula C16H21ClN2O3S and a molecular weight of 356.88 g/mol. Its IUPAC name is tert-butyl 4-(3-chlorophenyl)-5-oxo-2-(sulfanylmethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-chlorophenyl)-5-oxo-2-(sulfanylmethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 57007246 |
| Molecular Formula | C16H21ClN2O3S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | tert-butyl 4-(3-chlorophenyl)-5-oxo-2-(sulfanylmethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)N(c2cccc(Cl)c2)CC1CS |
| InChI | InChI=1S/C16H21ClN2O3S/c1-16(2,3)22-15(21)19-9-14(20)18(8-13(19)10-23)12-6-4-5-11(17)7-12/h4-7,13,23H,8-10H2,1-3H3 |
| InChIKey | SVAQVWDCRBDWHQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|