C53H78O5 — CID 57007561
1,7-bis[2-hydroxy-6-methyl-3,5-bis(3-methylbut-2-enyl)-4-pent-2-en-3-yloxyphenyl]-2,6-dimethylheptan-4-one (PubChem CID 57007561) has the molecular formula C53H78O5 and a molecular weight of 795.20 g/mol. Its IUPAC name is 1,7-bis[2-hydroxy-6-methyl-3,5-bis(3-methylbut-2-enyl)-4-pent-2-en-3-yloxyphenyl]-2,6-dimethylheptan-4-one.
| Compound Name | 1,7-bis[2-hydroxy-6-methyl-3,5-bis(3-methylbut-2-enyl)-4-pent-2-en-3-yloxyphenyl]-2,6-dimethylheptan-4-one |
|---|---|
| PubChem CID | 57007561 |
| Molecular Formula | C53H78O5 |
| Molecular Weight | 795.20 g/mol |
| Exact Mass | 794.58 |
| IUPAC Name | 1,7-bis[2-hydroxy-6-methyl-3,5-bis(3-methylbut-2-enyl)-4-pent-2-en-3-yloxyphenyl]-2,6-dimethylheptan-4-one |
| SMILES | CC=C(CC)Oc1c(CC=C(C)C)c(C)c(CC(C)CC(=O)CC(C)Cc2c(C)c(CC=C(C)C)c(OC(=CC)CC)c(CC=C(C)C)c2O)c(O)c1CC=C(C)C |
| InChI | InChI=1S/C53H78O5/c1-17-42(18-2)57-52-44(25-21-33(5)6)39(15)48(50(55)46(52)27-23-35(9)10)31-37(13)29-41(54)30-38(14)32-49-40(16)45(26-22-34(7)8)53(58-43(19-3)20-4)47(51(49)56)28-24-36(11)12/h17,19,21-24,37-38,55-56H,18,20,25-32H2,1-16H3 |
| InChIKey | XKXYMSLKFBOOQS-UHFFFAOYSA-N |
| XLogP | 14.54 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.20 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|