C20H15Br — CID 57007724
1-(4-bromophenyl)-9,10-dihydroanthracene (PubChem CID 57007724) has the molecular formula C20H15Br and a molecular weight of 335.24 g/mol. Its IUPAC name is 1-(4-bromophenyl)-9,10-dihydroanthracene.
| Compound Name | 1-(4-bromophenyl)-9,10-dihydroanthracene |
|---|---|
| PubChem CID | 57007724 |
| Molecular Formula | C20H15Br |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1-(4-bromophenyl)-9,10-dihydroanthracene |
| SMILES | Brc1ccc(-c2cccc3c2Cc2ccccc2C3)cc1 |
| InChI | InChI=1S/C20H15Br/c21-18-10-8-14(9-11-18)19-7-3-6-17-12-15-4-1-2-5-16(15)13-20(17)19/h1-11H,12-13H2 |
| InChIKey | LMMPKXHTWVRIDP-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |