C9H17N5O2 — CID 57007738
4-(diaminomethylideneamino)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine-6-carboxylic acid (PubChem CID 57007738) has the molecular formula C9H17N5O2 and a molecular weight of 227.27 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine-6-carboxylic acid.
| Compound Name | 4-(diaminomethylideneamino)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine-6-carboxylic acid |
|---|---|
| PubChem CID | 57007738 |
| Molecular Formula | C9H17N5O2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 4-(diaminomethylideneamino)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine-6-carboxylic acid |
| SMILES | NC(N)=NC1CNCC2CCC(C(=O)O)N21 |
| InChI | InChI=1S/C9H17N5O2/c10-9(11)13-7-4-12-3-5-1-2-6(8(15)16)14(5)7/h5-7,12H,1-4H2,(H,15,16)(H4,10,11,13) |
| InChIKey | VVQTXSZVAAQFLD-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 116.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|