C10H9F5O5 — CID 57007818
(1,1-difluoro-2,4-dioxopentan-3-yl) 4,4,4-trifluoro-2-methyl-3-oxobutanoate (PubChem CID 57007818) has the molecular formula C10H9F5O5 and a molecular weight of 304.17 g/mol. Its IUPAC name is (1,1-difluoro-2,4-dioxopentan-3-yl) 4,4,4-trifluoro-2-methyl-3-oxobutanoate.
| Compound Name | (1,1-difluoro-2,4-dioxopentan-3-yl) 4,4,4-trifluoro-2-methyl-3-oxobutanoate |
|---|---|
| PubChem CID | 57007818 |
| Molecular Formula | C10H9F5O5 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | (1,1-difluoro-2,4-dioxopentan-3-yl) 4,4,4-trifluoro-2-methyl-3-oxobutanoate |
| SMILES | CC(=O)C(OC(=O)C(C)C(=O)C(F)(F)F)C(=O)C(F)F |
| InChI | InChI=1S/C10H9F5O5/c1-3(7(18)10(13,14)15)9(19)20-6(4(2)16)5(17)8(11)12/h3,6,8H,1-2H3 |
| InChIKey | BMMCJHQNWCDRHN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|